C15H24N2O2S — CID 64610553
3,3-dimethyl-1-(2-nitrophenyl)sulfanyl-N-propylbutan-2-amine (PubChem CID 64610553) has the molecular formula C15H24N2O2S and a molecular weight of 296.44 g/mol. Its IUPAC name is 3,3-dimethyl-1-(2-nitrophenyl)sulfanyl-N-propylbutan-2-amine.
| Compound Name | 3,3-dimethyl-1-(2-nitrophenyl)sulfanyl-N-propylbutan-2-amine |
|---|---|
| PubChem CID | 64610553 |
| Molecular Formula | C15H24N2O2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 3,3-dimethyl-1-(2-nitrophenyl)sulfanyl-N-propylbutan-2-amine |
| SMILES | CCCNC(CSc1ccccc1[N+](=O)[O-])C(C)(C)C |
| InChI | InChI=1S/C15H24N2O2S/c1-5-10-16-14(15(2,3)4)11-20-13-9-7-6-8-12(13)17(18)19/h6-9,14,16H,5,10-11H2,1-4H3 |
| InChIKey | XODVAHKWWCWBDU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|