C16H25FN2O2 — CID 60995850
1-(5-fluoro-2-nitrophenyl)-4,4-dimethyl-N-propylpentan-3-amine (PubChem CID 60995850) has the molecular formula C16H25FN2O2 and a molecular weight of 296.39 g/mol. Its IUPAC name is 1-(5-fluoro-2-nitrophenyl)-4,4-dimethyl-N-propylpentan-3-amine.
| Compound Name | 1-(5-fluoro-2-nitrophenyl)-4,4-dimethyl-N-propylpentan-3-amine |
|---|---|
| PubChem CID | 60995850 |
| Molecular Formula | C16H25FN2O2 |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | 1-(5-fluoro-2-nitrophenyl)-4,4-dimethyl-N-propylpentan-3-amine |
| SMILES | CCCNC(CCc1cc(F)ccc1[N+](=O)[O-])C(C)(C)C |
| InChI | InChI=1S/C16H25FN2O2/c1-5-10-18-15(16(2,3)4)9-6-12-11-13(17)7-8-14(12)19(20)21/h7-8,11,15,18H,5-6,9-10H2,1-4H3 |
| InChIKey | UXYFNYARAMFSPJ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|