C14H21FN2O2 — CID 54891057
1-(5-fluoro-2-nitrophenyl)-N,4,4-trimethylpentan-3-amine (PubChem CID 54891057) has the molecular formula C14H21FN2O2 and a molecular weight of 268.33 g/mol. Its IUPAC name is 1-(5-fluoro-2-nitrophenyl)-N,4,4-trimethylpentan-3-amine.
| Compound Name | 1-(5-fluoro-2-nitrophenyl)-N,4,4-trimethylpentan-3-amine |
|---|---|
| PubChem CID | 54891057 |
| Molecular Formula | C14H21FN2O2 |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 1-(5-fluoro-2-nitrophenyl)-N,4,4-trimethylpentan-3-amine |
| SMILES | CNC(CCc1cc(F)ccc1[N+](=O)[O-])C(C)(C)C |
| InChI | InChI=1S/C14H21FN2O2/c1-14(2,3)13(16-4)8-5-10-9-11(15)6-7-12(10)17(18)19/h6-7,9,13,16H,5,8H2,1-4H3 |
| InChIKey | MMOPUHUOWVOKOP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|