C12H19NO3S2 — CID 64929920
3-(methylamino)-4-(4-methylsulfonylphenyl)sulfanylbutan-1-ol (PubChem CID 64929920) has the molecular formula C12H19NO3S2 and a molecular weight of 289.42 g/mol. Its IUPAC name is 3-(methylamino)-4-(4-methylsulfonylphenyl)sulfanylbutan-1-ol.
| Compound Name | 3-(methylamino)-4-(4-methylsulfonylphenyl)sulfanylbutan-1-ol |
|---|---|
| PubChem CID | 64929920 |
| Molecular Formula | C12H19NO3S2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 3-(methylamino)-4-(4-methylsulfonylphenyl)sulfanylbutan-1-ol |
| SMILES | CNC(CCO)CSc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C12H19NO3S2/c1-13-10(7-8-14)9-17-11-3-5-12(6-4-11)18(2,15)16/h3-6,10,13-14H,7-9H2,1-2H3 |
| InChIKey | IPRZRSFZAWLKLW-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |