C12H18ClNO2S2 — CID 66143966
1-(4-chlorophenyl)sulfanyl-N-methyl-4-methylsulfonylbutan-2-amine (PubChem CID 66143966) has the molecular formula C12H18ClNO2S2 and a molecular weight of 307.87 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfanyl-N-methyl-4-methylsulfonylbutan-2-amine.
| Compound Name | 1-(4-chlorophenyl)sulfanyl-N-methyl-4-methylsulfonylbutan-2-amine |
|---|---|
| PubChem CID | 66143966 |
| Molecular Formula | C12H18ClNO2S2 |
| Molecular Weight | 307.87 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 1-(4-chlorophenyl)sulfanyl-N-methyl-4-methylsulfonylbutan-2-amine |
| SMILES | CNC(CCS(C)(=O)=O)CSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H18ClNO2S2/c1-14-11(7-8-18(2,15)16)9-17-12-5-3-10(13)4-6-12/h3-6,11,14H,7-9H2,1-2H3 |
| InChIKey | AIAYDGIKHDWRTG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.87 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |