C10H14O3S2 — CID 106933378
(2R)-1-(4-methylsulfonylphenyl)sulfanylpropan-2-ol (PubChem CID 106933378) has the molecular formula C10H14O3S2 and a molecular weight of 246.35 g/mol. Its IUPAC name is (2R)-1-(4-methylsulfonylphenyl)sulfanylpropan-2-ol.
| Compound Name | (2R)-1-(4-methylsulfonylphenyl)sulfanylpropan-2-ol |
|---|---|
| PubChem CID | 106933378 |
| Molecular Formula | C10H14O3S2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | (2R)-1-(4-methylsulfonylphenyl)sulfanylpropan-2-ol |
| SMILES | C[C@@H](O)CSc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C10H14O3S2/c1-8(11)7-14-9-3-5-10(6-4-9)15(2,12)13/h3-6,8,11H,7H2,1-2H3/t8-/m1/s1 |
| InChIKey | CIKTWIQDDQQODV-MRVPVSSYSA-N |
| XLogP | 1.56 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |