C17H20O3S2 — CID 110885160
2-(3,4-dimethylphenyl)sulfanyl-1-(4-methylsulfonylphenyl)ethanol (PubChem CID 110885160) has the molecular formula C17H20O3S2 and a molecular weight of 336.48 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)sulfanyl-1-(4-methylsulfonylphenyl)ethanol.
| Compound Name | 2-(3,4-dimethylphenyl)sulfanyl-1-(4-methylsulfonylphenyl)ethanol |
|---|---|
| PubChem CID | 110885160 |
| Molecular Formula | C17H20O3S2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 2-(3,4-dimethylphenyl)sulfanyl-1-(4-methylsulfonylphenyl)ethanol |
| SMILES | Cc1ccc(SCC(O)c2ccc(S(C)(=O)=O)cc2)cc1C |
| InChI | InChI=1S/C17H20O3S2/c1-12-4-7-15(10-13(12)2)21-11-17(18)14-5-8-16(9-6-14)22(3,19)20/h4-10,17-18H,11H2,1-3H3 |
| InChIKey | KTAGSPUJLQTROZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |