C11H18O2S — CID 142336805
1,2-dimethyl-4-methylsulfonylbenzene;ethane (PubChem CID 142336805) has the molecular formula C11H18O2S and a molecular weight of 214.33 g/mol. Its IUPAC name is 1,2-dimethyl-4-methylsulfonylbenzene;ethane.
| Compound Name | 1,2-dimethyl-4-methylsulfonylbenzene;ethane |
|---|---|
| PubChem CID | 142336805 |
| Molecular Formula | C11H18O2S |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 1,2-dimethyl-4-methylsulfonylbenzene;ethane |
| SMILES | CC.Cc1ccc(S(C)(=O)=O)cc1C |
| InChI | InChI=1S/C9H12O2S.C2H6/c1-7-4-5-9(6-8(7)2)12(3,10)11;1-2/h4-6H,1-3H3;1-2H3 |
| InChIKey | HGKYJDHDNKIHHI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |