C11H16O2S — CID 58551166
1,2-dimethyl-4-propan-2-ylsulfonylbenzene (PubChem CID 58551166) has the molecular formula C11H16O2S and a molecular weight of 212.31 g/mol. Its IUPAC name is 1,2-dimethyl-4-propan-2-ylsulfonylbenzene.
| Compound Name | 1,2-dimethyl-4-propan-2-ylsulfonylbenzene |
|---|---|
| PubChem CID | 58551166 |
| Molecular Formula | C11H16O2S |
| Molecular Weight | 212.31 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 1,2-dimethyl-4-propan-2-ylsulfonylbenzene |
| SMILES | Cc1ccc(S(=O)(=O)C(C)C)cc1C |
| InChI | InChI=1S/C11H16O2S/c1-8(2)14(12,13)11-6-5-9(3)10(4)7-11/h5-8H,1-4H3 |
| InChIKey | YBQMPYWGSYATAE-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |