C15H23NO3S — CID 86992879
2-(3,4-dimethylphenyl)sulfonyl-N,N-diethylpropanamide (PubChem CID 86992879) has the molecular formula C15H23NO3S and a molecular weight of 297.42 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)sulfonyl-N,N-diethylpropanamide.
| Compound Name | 2-(3,4-dimethylphenyl)sulfonyl-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 86992879 |
| Molecular Formula | C15H23NO3S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 2-(3,4-dimethylphenyl)sulfonyl-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)C(C)S(=O)(=O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C15H23NO3S/c1-6-16(7-2)15(17)13(5)20(18,19)14-9-8-11(3)12(4)10-14/h8-10,13H,6-7H2,1-5H3 |
| InChIKey | SBPHUBQGRSMZIM-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |