C16H26N2O3S — CID 78777279
5-(diethylsulfamoyl)-N,N-diethyl-2-methylbenzamide (PubChem CID 78777279) has the molecular formula C16H26N2O3S and a molecular weight of 326.46 g/mol. Its IUPAC name is 5-(diethylsulfamoyl)-N,N-diethyl-2-methylbenzamide.
| Compound Name | 5-(diethylsulfamoyl)-N,N-diethyl-2-methylbenzamide |
|---|---|
| PubChem CID | 78777279 |
| Molecular Formula | C16H26N2O3S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 5-(diethylsulfamoyl)-N,N-diethyl-2-methylbenzamide |
| SMILES | CCN(CC)C(=O)c1cc(S(=O)(=O)N(CC)CC)ccc1C |
| InChI | InChI=1S/C16H26N2O3S/c1-6-17(7-2)16(19)15-12-14(11-10-13(15)5)22(20,21)18(8-3)9-4/h10-12H,6-9H2,1-5H3 |
| InChIKey | ZKDBCWWKPKWIND-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |