C15H21F3N2O3S — CID 55675449
5-(diethylsulfamoyl)-N,2-dimethyl-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 55675449) has the molecular formula C15H21F3N2O3S and a molecular weight of 366.41 g/mol. Its IUPAC name is 5-(diethylsulfamoyl)-N,2-dimethyl-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 5-(diethylsulfamoyl)-N,2-dimethyl-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 55675449 |
| Molecular Formula | C15H21F3N2O3S |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 5-(diethylsulfamoyl)-N,2-dimethyl-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C)c(C(=O)N(C)CC(F)(F)F)c1 |
| InChI | InChI=1S/C15H21F3N2O3S/c1-5-20(6-2)24(22,23)12-8-7-11(3)13(9-12)14(21)19(4)10-15(16,17)18/h7-9H,5-6,10H2,1-4H3 |
| InChIKey | IDNGZADVCQDWOO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |