C11H12F4N2O3S — CID 81480170
2-fluoro-N,3-dimethyl-5-sulfamoyl-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 81480170) has the molecular formula C11H12F4N2O3S and a molecular weight of 328.29 g/mol. Its IUPAC name is 2-fluoro-N,3-dimethyl-5-sulfamoyl-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 2-fluoro-N,3-dimethyl-5-sulfamoyl-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 81480170 |
| Molecular Formula | C11H12F4N2O3S |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | 2-fluoro-N,3-dimethyl-5-sulfamoyl-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | Cc1cc(S(N)(=O)=O)cc(C(=O)N(C)CC(F)(F)F)c1F |
| InChI | InChI=1S/C11H12F4N2O3S/c1-6-3-7(21(16,19)20)4-8(9(6)12)10(18)17(2)5-11(13,14)15/h3-4H,5H2,1-2H3,(H2,16,19,20) |
| InChIKey | OSJGVVHBGAYEJO-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |