C13H19FN2O4S — CID 81482028
2-fluoro-N-(3-methoxypropyl)-N,3-dimethyl-5-sulfamoylbenzamide (PubChem CID 81482028) has the molecular formula C13H19FN2O4S and a molecular weight of 318.37 g/mol. Its IUPAC name is 2-fluoro-N-(3-methoxypropyl)-N,3-dimethyl-5-sulfamoylbenzamide.
| Compound Name | 2-fluoro-N-(3-methoxypropyl)-N,3-dimethyl-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 81482028 |
| Molecular Formula | C13H19FN2O4S |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 2-fluoro-N-(3-methoxypropyl)-N,3-dimethyl-5-sulfamoylbenzamide |
| SMILES | COCCCN(C)C(=O)c1cc(S(N)(=O)=O)cc(C)c1F |
| InChI | InChI=1S/C13H19FN2O4S/c1-9-7-10(21(15,18)19)8-11(12(9)14)13(17)16(2)5-4-6-20-3/h7-8H,4-6H2,1-3H3,(H2,15,18,19) |
| InChIKey | AUIFHNYFUCRHDB-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|