C12H16F2N2O4S — CID 63374883
2,6-difluoro-N-(3-methoxypropyl)-N-methyl-3-sulfamoylbenzamide (PubChem CID 63374883) has the molecular formula C12H16F2N2O4S and a molecular weight of 322.33 g/mol. Its IUPAC name is 2,6-difluoro-N-(3-methoxypropyl)-N-methyl-3-sulfamoylbenzamide.
| Compound Name | 2,6-difluoro-N-(3-methoxypropyl)-N-methyl-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 63374883 |
| Molecular Formula | C12H16F2N2O4S |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 2,6-difluoro-N-(3-methoxypropyl)-N-methyl-3-sulfamoylbenzamide |
| SMILES | COCCCN(C)C(=O)c1c(F)ccc(S(N)(=O)=O)c1F |
| InChI | InChI=1S/C12H16F2N2O4S/c1-16(6-3-7-20-2)12(17)10-8(13)4-5-9(11(10)14)21(15,18)19/h4-5H,3,6-7H2,1-2H3,(H2,15,18,19) |
| InChIKey | RFKJHQNUNZLMNA-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|