C13H19ClN2O4S — CID 65387897
3-chloro-N-(3-methoxypropyl)-N,4-dimethyl-5-sulfamoylbenzamide (PubChem CID 65387897) has the molecular formula C13H19ClN2O4S and a molecular weight of 334.83 g/mol. Its IUPAC name is 3-chloro-N-(3-methoxypropyl)-N,4-dimethyl-5-sulfamoylbenzamide.
| Compound Name | 3-chloro-N-(3-methoxypropyl)-N,4-dimethyl-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 65387897 |
| Molecular Formula | C13H19ClN2O4S |
| Molecular Weight | 334.83 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 3-chloro-N-(3-methoxypropyl)-N,4-dimethyl-5-sulfamoylbenzamide |
| SMILES | COCCCN(C)C(=O)c1cc(Cl)c(C)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C13H19ClN2O4S/c1-9-11(14)7-10(8-12(9)21(15,18)19)13(17)16(2)5-4-6-20-3/h7-8H,4-6H2,1-3H3,(H2,15,18,19) |
| InChIKey | UZUMRDDJTKVRND-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.83 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|