C13H19ClN2O3S — CID 65388313
3-chloro-N-ethyl-4-methyl-N-propan-2-yl-5-sulfamoylbenzamide (PubChem CID 65388313) has the molecular formula C13H19ClN2O3S and a molecular weight of 318.83 g/mol. Its IUPAC name is 3-chloro-N-ethyl-4-methyl-N-propan-2-yl-5-sulfamoylbenzamide.
| Compound Name | 3-chloro-N-ethyl-4-methyl-N-propan-2-yl-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 65388313 |
| Molecular Formula | C13H19ClN2O3S |
| Molecular Weight | 318.83 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 3-chloro-N-ethyl-4-methyl-N-propan-2-yl-5-sulfamoylbenzamide |
| SMILES | CCN(C(=O)c1cc(Cl)c(C)c(S(N)(=O)=O)c1)C(C)C |
| InChI | InChI=1S/C13H19ClN2O3S/c1-5-16(8(2)3)13(17)10-6-11(14)9(4)12(7-10)20(15,18)19/h6-8H,5H2,1-4H3,(H2,15,18,19) |
| InChIKey | IYWQURSXBYFXKV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.83 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |