C12H17ClN2O3S — CID 65387181
3-chloro-N,4-dimethyl-N-propyl-5-sulfamoylbenzamide (PubChem CID 65387181) has the molecular formula C12H17ClN2O3S and a molecular weight of 304.80 g/mol. Its IUPAC name is 3-chloro-N,4-dimethyl-N-propyl-5-sulfamoylbenzamide.
| Compound Name | 3-chloro-N,4-dimethyl-N-propyl-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 65387181 |
| Molecular Formula | C12H17ClN2O3S |
| Molecular Weight | 304.80 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 3-chloro-N,4-dimethyl-N-propyl-5-sulfamoylbenzamide |
| SMILES | CCCN(C)C(=O)c1cc(Cl)c(C)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C12H17ClN2O3S/c1-4-5-15(3)12(16)9-6-10(13)8(2)11(7-9)19(14,17)18/h6-7H,4-5H2,1-3H3,(H2,14,17,18) |
| InChIKey | GDSXUHGWPQOTRG-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.80 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |