C8H7Cl2NO3S — CID 21394744
3-chloro-4-methyl-5-sulfamoylbenzoyl chloride (PubChem CID 21394744) has the molecular formula C8H7Cl2NO3S and a molecular weight of 268.12 g/mol. Its IUPAC name is 3-chloro-4-methyl-5-sulfamoylbenzoyl chloride.
| Compound Name | 3-chloro-4-methyl-5-sulfamoylbenzoyl chloride |
|---|---|
| PubChem CID | 21394744 |
| Molecular Formula | C8H7Cl2NO3S |
| Molecular Weight | 268.12 g/mol |
| Exact Mass | 266.95 |
| IUPAC Name | 3-chloro-4-methyl-5-sulfamoylbenzoyl chloride |
| SMILES | Cc1c(Cl)cc(C(=O)Cl)cc1S(N)(=O)=O |
| InChI | InChI=1S/C8H7Cl2NO3S/c1-4-6(9)2-5(8(10)12)3-7(4)15(11,13)14/h2-3H,1H3,(H2,11,13,14) |
| InChIKey | KXMDTAVLBDHXGY-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.12 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|