C12H15ClN2O4S — CID 65375991
3-chloro-2-methyl-5-(morpholine-4-carbonyl)benzenesulfonamide (PubChem CID 65375991) has the molecular formula C12H15ClN2O4S and a molecular weight of 318.78 g/mol. Its IUPAC name is 3-chloro-2-methyl-5-(morpholine-4-carbonyl)benzenesulfonamide.
| Compound Name | 3-chloro-2-methyl-5-(morpholine-4-carbonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 65375991 |
| Molecular Formula | C12H15ClN2O4S |
| Molecular Weight | 318.78 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 3-chloro-2-methyl-5-(morpholine-4-carbonyl)benzenesulfonamide |
| SMILES | Cc1c(Cl)cc(C(=O)N2CCOCC2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C12H15ClN2O4S/c1-8-10(13)6-9(7-11(8)20(14,17)18)12(16)15-2-4-19-5-3-15/h6-7H,2-5H2,1H3,(H2,14,17,18) |
| InChIKey | XCGKMAJJOLUAFU-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.78 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |