C11H12Cl2N2O4S — CID 65375063
2,5-dichloro-3-(morpholine-4-carbonyl)benzenesulfonamide (PubChem CID 65375063) has the molecular formula C11H12Cl2N2O4S and a molecular weight of 339.20 g/mol. Its IUPAC name is 2,5-dichloro-3-(morpholine-4-carbonyl)benzenesulfonamide.
| Compound Name | 2,5-dichloro-3-(morpholine-4-carbonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 65375063 |
| Molecular Formula | C11H12Cl2N2O4S |
| Molecular Weight | 339.20 g/mol |
| Exact Mass | 337.99 |
| IUPAC Name | 2,5-dichloro-3-(morpholine-4-carbonyl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc(Cl)cc(C(=O)N2CCOCC2)c1Cl |
| InChI | InChI=1S/C11H12Cl2N2O4S/c12-7-5-8(10(13)9(6-7)20(14,17)18)11(16)15-1-3-19-4-2-15/h5-6H,1-4H2,(H2,14,17,18) |
| InChIKey | BQRJIRUVNNYMHH-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.20 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |