C11H13NO5 — CID 3047894
morpholin-4-yl-(3,4,5-trihydroxyphenyl)methanone (PubChem CID 3047894) has the molecular formula C11H13NO5 and a molecular weight of 239.23 g/mol. Its IUPAC name is morpholin-4-yl-(3,4,5-trihydroxyphenyl)methanone.
| Compound Name | morpholin-4-yl-(3,4,5-trihydroxyphenyl)methanone |
|---|---|
| PubChem CID | 3047894 |
| Molecular Formula | C11H13NO5 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | morpholin-4-yl-(3,4,5-trihydroxyphenyl)methanone |
| SMILES | O=C(c1cc(O)c(O)c(O)c1)N1CCOCC1 |
| InChI | InChI=1S/C11H13NO5/c13-8-5-7(6-9(14)10(8)15)11(16)12-1-3-17-4-2-12/h5-6,13-15H,1-4H2 |
| InChIKey | WYRHCBQBVYYPQX-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|