C12H12F2N2O3 — CID 68557409
2,6-difluoro-4-(morpholine-4-carbonyl)benzamide (PubChem CID 68557409) has the molecular formula C12H12F2N2O3 and a molecular weight of 270.24 g/mol. Its IUPAC name is 2,6-difluoro-4-(morpholine-4-carbonyl)benzamide.
| Compound Name | 2,6-difluoro-4-(morpholine-4-carbonyl)benzamide |
|---|---|
| PubChem CID | 68557409 |
| Molecular Formula | C12H12F2N2O3 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 2,6-difluoro-4-(morpholine-4-carbonyl)benzamide |
| SMILES | NC(=O)c1c(F)cc(C(=O)N2CCOCC2)cc1F |
| InChI | InChI=1S/C12H12F2N2O3/c13-8-5-7(6-9(14)10(8)11(15)17)12(18)16-1-3-19-4-2-16/h5-6H,1-4H2,(H2,15,17) |
| InChIKey | MTOYFDMQBUFQPZ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |