C13H12F3N3O3 — CID 67547799
2-oxo-2-[4-(3,4,5-trifluorobenzoyl)piperazin-1-yl]acetamide (PubChem CID 67547799) has the molecular formula C13H12F3N3O3 and a molecular weight of 315.25 g/mol. Its IUPAC name is 2-oxo-2-[4-(3,4,5-trifluorobenzoyl)piperazin-1-yl]acetamide.
| Compound Name | 2-oxo-2-[4-(3,4,5-trifluorobenzoyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 67547799 |
| Molecular Formula | C13H12F3N3O3 |
| Molecular Weight | 315.25 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 2-oxo-2-[4-(3,4,5-trifluorobenzoyl)piperazin-1-yl]acetamide |
| SMILES | NC(=O)C(=O)N1CCN(C(=O)c2cc(F)c(F)c(F)c2)CC1 |
| InChI | InChI=1S/C13H12F3N3O3/c14-8-5-7(6-9(15)10(8)16)12(21)18-1-3-19(4-2-18)13(22)11(17)20/h5-6H,1-4H2,(H2,17,20) |
| InChIKey | CHHZSJPBOSOTOQ-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.25 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|