C13H14F3N3O2 — CID 87531421
2-amino-2-[4-(3,4,5-trifluorobenzoyl)piperazin-1-yl]acetaldehyde (PubChem CID 87531421) has the molecular formula C13H14F3N3O2 and a molecular weight of 301.27 g/mol. Its IUPAC name is 2-amino-2-[4-(3,4,5-trifluorobenzoyl)piperazin-1-yl]acetaldehyde.
| Compound Name | 2-amino-2-[4-(3,4,5-trifluorobenzoyl)piperazin-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 87531421 |
| Molecular Formula | C13H14F3N3O2 |
| Molecular Weight | 301.27 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 2-amino-2-[4-(3,4,5-trifluorobenzoyl)piperazin-1-yl]acetaldehyde |
| SMILES | NC(C=O)N1CCN(C(=O)c2cc(F)c(F)c(F)c2)CC1 |
| InChI | InChI=1S/C13H14F3N3O2/c14-9-5-8(6-10(15)12(9)16)13(21)19-3-1-18(2-4-19)11(17)7-20/h5-7,11H,1-4,17H2 |
| InChIKey | PXKUNPQWXHEEST-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.27 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|