C15H18F2N4O2 — CID 165404002
[3,4-difluoro-5-[(1Z)-1,4,4-triaminobuta-1,3-dienyl]phenyl]-morpholin-4-ylmethanone (PubChem CID 165404002) has the molecular formula C15H18F2N4O2 and a molecular weight of 324.33 g/mol. Its IUPAC name is [3,4-difluoro-5-[(1Z)-1,4,4-triaminobuta-1,3-dienyl]phenyl]-morpholin-4-ylmethanone.
| Compound Name | [3,4-difluoro-5-[(1Z)-1,4,4-triaminobuta-1,3-dienyl]phenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 165404002 |
| Molecular Formula | C15H18F2N4O2 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | [3,4-difluoro-5-[(1Z)-1,4,4-triaminobuta-1,3-dienyl]phenyl]-morpholin-4-ylmethanone |
| SMILES | NC(N)=C/C=C(\N)c1cc(C(=O)N2CCOCC2)cc(F)c1F |
| InChI | InChI=1S/C15H18F2N4O2/c16-11-8-9(15(22)21-3-5-23-6-4-21)7-10(14(11)17)12(18)1-2-13(19)20/h1-2,7-8H,3-6,18-20H2/b12-1- |
| InChIKey | XDTPXKNTHOOLQN-VIJZIMQTSA-N |
| XLogP | 0.50 |
| TPSA | 107.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|