C11H14Cl2N2O3S — CID 60635894
2,4-dichloro-N,N-diethyl-5-sulfamoylbenzamide (PubChem CID 60635894) has the molecular formula C11H14Cl2N2O3S and a molecular weight of 325.22 g/mol. Its IUPAC name is 2,4-dichloro-N,N-diethyl-5-sulfamoylbenzamide.
| Compound Name | 2,4-dichloro-N,N-diethyl-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 60635894 |
| Molecular Formula | C11H14Cl2N2O3S |
| Molecular Weight | 325.22 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | 2,4-dichloro-N,N-diethyl-5-sulfamoylbenzamide |
| SMILES | CCN(CC)C(=O)c1cc(S(N)(=O)=O)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H14Cl2N2O3S/c1-3-15(4-2)11(16)7-5-10(19(14,17)18)9(13)6-8(7)12/h5-6H,3-4H2,1-2H3,(H2,14,17,18) |
| InChIKey | YYXWZRMLJFKCDN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.22 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |