C16H26N2O5S — CID 23353687
N,N-diethyl-3,4-dimethoxy-2-propan-2-yl-5-sulfamoylbenzamide (PubChem CID 23353687) has the molecular formula C16H26N2O5S and a molecular weight of 358.46 g/mol. Its IUPAC name is N,N-diethyl-3,4-dimethoxy-2-propan-2-yl-5-sulfamoylbenzamide.
| Compound Name | N,N-diethyl-3,4-dimethoxy-2-propan-2-yl-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 23353687 |
| Molecular Formula | C16H26N2O5S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | N,N-diethyl-3,4-dimethoxy-2-propan-2-yl-5-sulfamoylbenzamide |
| SMILES | CCN(CC)C(=O)c1cc(S(N)(=O)=O)c(OC)c(OC)c1C(C)C |
| InChI | InChI=1S/C16H26N2O5S/c1-7-18(8-2)16(19)11-9-12(24(17,20)21)14(22-5)15(23-6)13(11)10(3)4/h9-10H,7-8H2,1-6H3,(H2,17,20,21) |
| InChIKey | FLPLQAQTSXGGPN-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |