C13H18ClNO5S — CID 102988512
pentan-2-yl 5-chloro-2-methoxy-3-sulfamoylbenzoate (PubChem CID 102988512) has the molecular formula C13H18ClNO5S and a molecular weight of 335.81 g/mol. Its IUPAC name is pentan-2-yl 5-chloro-2-methoxy-3-sulfamoylbenzoate.
| Compound Name | pentan-2-yl 5-chloro-2-methoxy-3-sulfamoylbenzoate |
|---|---|
| PubChem CID | 102988512 |
| Molecular Formula | C13H18ClNO5S |
| Molecular Weight | 335.81 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | pentan-2-yl 5-chloro-2-methoxy-3-sulfamoylbenzoate |
| SMILES | CCCC(C)OC(=O)c1cc(Cl)cc(S(N)(=O)=O)c1OC |
| InChI | InChI=1S/C13H18ClNO5S/c1-4-5-8(2)20-13(16)10-6-9(14)7-11(12(10)19-3)21(15,17)18/h6-8H,4-5H2,1-3H3,(H2,15,17,18) |
| InChIKey | ADCCZOIZUYBZMB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.81 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |