C11H13ClFNO5S — CID 65381105
1-methoxypropan-2-yl 5-chloro-2-fluoro-3-sulfamoylbenzoate (PubChem CID 65381105) has the molecular formula C11H13ClFNO5S and a molecular weight of 325.75 g/mol. Its IUPAC name is 1-methoxypropan-2-yl 5-chloro-2-fluoro-3-sulfamoylbenzoate.
| Compound Name | 1-methoxypropan-2-yl 5-chloro-2-fluoro-3-sulfamoylbenzoate |
|---|---|
| PubChem CID | 65381105 |
| Molecular Formula | C11H13ClFNO5S |
| Molecular Weight | 325.75 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | 1-methoxypropan-2-yl 5-chloro-2-fluoro-3-sulfamoylbenzoate |
| SMILES | COCC(C)OC(=O)c1cc(Cl)cc(S(N)(=O)=O)c1F |
| InChI | InChI=1S/C11H13ClFNO5S/c1-6(5-18-2)19-11(15)8-3-7(12)4-9(10(8)13)20(14,16)17/h3-4,6H,5H2,1-2H3,(H2,14,16,17) |
| InChIKey | NXFASQQEUSUHNE-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.75 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |