C11H11ClF2O5S — CID 65375121
1-methoxypropan-2-yl 3-chlorosulfonyl-2,6-difluorobenzoate (PubChem CID 65375121) has the molecular formula C11H11ClF2O5S and a molecular weight of 328.72 g/mol. Its IUPAC name is 1-methoxypropan-2-yl 3-chlorosulfonyl-2,6-difluorobenzoate.
| Compound Name | 1-methoxypropan-2-yl 3-chlorosulfonyl-2,6-difluorobenzoate |
|---|---|
| PubChem CID | 65375121 |
| Molecular Formula | C11H11ClF2O5S |
| Molecular Weight | 328.72 g/mol |
| Exact Mass | 328.00 |
| IUPAC Name | 1-methoxypropan-2-yl 3-chlorosulfonyl-2,6-difluorobenzoate |
| SMILES | COCC(C)OC(=O)c1c(F)ccc(S(=O)(=O)Cl)c1F |
| InChI | InChI=1S/C11H11ClF2O5S/c1-6(5-18-2)19-11(15)9-7(13)3-4-8(10(9)14)20(12,16)17/h3-4,6H,5H2,1-2H3 |
| InChIKey | ZXCCQNDFXWORTG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.72 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |