C12H14ClF2NO3S — CID 65370851
2,4-difluoro-3-(pentan-3-ylcarbamoyl)benzenesulfonyl chloride (PubChem CID 65370851) has the molecular formula C12H14ClF2NO3S and a molecular weight of 325.76 g/mol. Its IUPAC name is 2,4-difluoro-3-(pentan-3-ylcarbamoyl)benzenesulfonyl chloride.
| Compound Name | 2,4-difluoro-3-(pentan-3-ylcarbamoyl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 65370851 |
| Molecular Formula | C12H14ClF2NO3S |
| Molecular Weight | 325.76 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | 2,4-difluoro-3-(pentan-3-ylcarbamoyl)benzenesulfonyl chloride |
| SMILES | CCC(CC)NC(=O)c1c(F)ccc(S(=O)(=O)Cl)c1F |
| InChI | InChI=1S/C12H14ClF2NO3S/c1-3-7(4-2)16-12(17)10-8(14)5-6-9(11(10)15)20(13,18)19/h5-7H,3-4H2,1-2H3,(H,16,17) |
| InChIKey | IKRTZVNEJCEZSH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.76 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |