About 1-methoxypropan-2-yl 3-chlorosulfonyl-5-fluoro-4-methoxybenzoate
1-methoxypropan-2-yl 3-chlorosulfonyl-5-fluoro-4-methoxybenzoate (PubChem CID 65374159) has the molecular formula C12H14ClFO6S
and a molecular weight of 340.76 g/mol. Its IUPAC name is 1-methoxypropan-2-yl 3-chlorosulfonyl-5-fluoro-4-methoxybenzoate.
Molecular Properties
| Compound Name | 1-methoxypropan-2-yl 3-chlorosulfonyl-5-fluoro-4-methoxybenzoate |
| PubChem CID | 65374159 |
| Molecular Formula | C12H14ClFO6S |
| Molecular Weight | 340.76 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | 1-methoxypropan-2-yl 3-chlorosulfonyl-5-fluoro-4-methoxybenzoate |
| SMILES | COCC(C)OC(=O)c1cc(F)c(OC)c(S(=O)(=O)Cl)c1 |
| InChI | InChI=1S/C12H14ClFO6S/c1-7(6-18-2)20-12(15)8-4-9(14)11(19-3)10(5-8)21(13,16)17/h4-5,7H,6H2,1-3H3 |
| InChIKey | OVYAEXSEUHMEKD-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.76 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-methoxypropan-2-yl 3-chlorosulfonyl-5-fluoro-4-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxypropan-2-yl 3-chlorosulfonyl-5-fluoro-4-methoxybenzoate?
The IUPAC name of 1-methoxypropan-2-yl 3-chlorosulfonyl-5-fluoro-4-methoxybenzoate (CID 65374159) is 1-methoxypropan-2-yl 3-chlorosulfonyl-5-fluoro-4-methoxybenzoate.
What is the SMILES notation for 1-methoxypropan-2-yl 3-chlorosulfonyl-5-fluoro-4-methoxybenzoate?
The canonical SMILES for 1-methoxypropan-2-yl 3-chlorosulfonyl-5-fluoro-4-methoxybenzoate is COCC(C)OC(=O)c1cc(F)c(OC)c(S(=O)(=O)Cl)c1.
What is the InChIKey of 1-methoxypropan-2-yl 3-chlorosulfonyl-5-fluoro-4-methoxybenzoate?
The InChIKey is OVYAEXSEUHMEKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClFO6S/c1-7(6-18-2)20-12(15)8-4-9(14)11(19-3)10(5-8)21(13,16)17/h4-5,7H,6H2,1-3H3.
What are the key properties of 1-methoxypropan-2-yl 3-chlorosulfonyl-5-fluoro-4-methoxybenzoate?
1-methoxypropan-2-yl 3-chlorosulfonyl-5-fluoro-4-methoxybenzoate has a molecular weight of 340.76 g/mol, XLogP of 1.95, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxypropan-2-yl 3-chlorosulfonyl-5-fluoro-4-methoxybenzoate is sourced from PubChem (CID 65374159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).