C12H11ClF2O4S — CID 106206902
2-cyclopropylethyl 3-chlorosulfonyl-2,6-difluorobenzoate (PubChem CID 106206902) has the molecular formula C12H11ClF2O4S and a molecular weight of 324.73 g/mol. Its IUPAC name is 2-cyclopropylethyl 3-chlorosulfonyl-2,6-difluorobenzoate.
| Compound Name | 2-cyclopropylethyl 3-chlorosulfonyl-2,6-difluorobenzoate |
|---|---|
| PubChem CID | 106206902 |
| Molecular Formula | C12H11ClF2O4S |
| Molecular Weight | 324.73 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | 2-cyclopropylethyl 3-chlorosulfonyl-2,6-difluorobenzoate |
| SMILES | O=C(OCCC1CC1)c1c(F)ccc(S(=O)(=O)Cl)c1F |
| InChI | InChI=1S/C12H11ClF2O4S/c13-20(17,18)9-4-3-8(14)10(11(9)15)12(16)19-6-5-7-1-2-7/h3-4,7H,1-2,5-6H2 |
| InChIKey | XKKWZUWIVLQULD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.73 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |