About 2-cyclopropylethyl 2-bromo-5-chlorosulfonyl-4-fluorobenzoate
2-cyclopropylethyl 2-bromo-5-chlorosulfonyl-4-fluorobenzoate (PubChem CID 106206963) has the molecular formula C12H11BrClFO4S
and a molecular weight of 385.64 g/mol. Its IUPAC name is 2-cyclopropylethyl 2-bromo-5-chlorosulfonyl-4-fluorobenzoate.
Molecular Properties
| Compound Name | 2-cyclopropylethyl 2-bromo-5-chlorosulfonyl-4-fluorobenzoate |
| PubChem CID | 106206963 |
| Molecular Formula | C12H11BrClFO4S |
| Molecular Weight | 385.64 g/mol |
| Exact Mass | 383.92 |
| IUPAC Name | 2-cyclopropylethyl 2-bromo-5-chlorosulfonyl-4-fluorobenzoate |
| SMILES | O=C(OCCC1CC1)c1cc(S(=O)(=O)Cl)c(F)cc1Br |
| InChI | InChI=1S/C12H11BrClFO4S/c13-9-6-10(15)11(20(14,17)18)5-8(9)12(16)19-4-3-7-1-2-7/h5-7H,1-4H2 |
| InChIKey | SHUQNETUFVMNTB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.64 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-cyclopropylethyl 2-bromo-5-chlorosulfonyl-4-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropylethyl 2-bromo-5-chlorosulfonyl-4-fluorobenzoate?
The IUPAC name of 2-cyclopropylethyl 2-bromo-5-chlorosulfonyl-4-fluorobenzoate (CID 106206963) is 2-cyclopropylethyl 2-bromo-5-chlorosulfonyl-4-fluorobenzoate.
What is the SMILES notation for 2-cyclopropylethyl 2-bromo-5-chlorosulfonyl-4-fluorobenzoate?
The canonical SMILES for 2-cyclopropylethyl 2-bromo-5-chlorosulfonyl-4-fluorobenzoate is O=C(OCCC1CC1)c1cc(S(=O)(=O)Cl)c(F)cc1Br.
What is the InChIKey of 2-cyclopropylethyl 2-bromo-5-chlorosulfonyl-4-fluorobenzoate?
The InChIKey is SHUQNETUFVMNTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11BrClFO4S/c13-9-6-10(15)11(20(14,17)18)5-8(9)12(16)19-4-3-7-1-2-7/h5-7H,1-4H2.
What are the key properties of 2-cyclopropylethyl 2-bromo-5-chlorosulfonyl-4-fluorobenzoate?
2-cyclopropylethyl 2-bromo-5-chlorosulfonyl-4-fluorobenzoate has a molecular weight of 385.64 g/mol, XLogP of 3.47, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropylethyl 2-bromo-5-chlorosulfonyl-4-fluorobenzoate is sourced from PubChem (CID 106206963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).