C12H14FNO4S — CID 113246509
2-cyclopropylethyl 2-fluoro-5-sulfamoylbenzoate (PubChem CID 113246509) has the molecular formula C12H14FNO4S and a molecular weight of 287.31 g/mol. Its IUPAC name is 2-cyclopropylethyl 2-fluoro-5-sulfamoylbenzoate.
| Compound Name | 2-cyclopropylethyl 2-fluoro-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 113246509 |
| Molecular Formula | C12H14FNO4S |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 2-cyclopropylethyl 2-fluoro-5-sulfamoylbenzoate |
| SMILES | NS(=O)(=O)c1ccc(F)c(C(=O)OCCC2CC2)c1 |
| InChI | InChI=1S/C12H14FNO4S/c13-11-4-3-9(19(14,16)17)7-10(11)12(15)18-6-5-8-1-2-8/h3-4,7-8H,1-2,5-6H2,(H2,14,16,17) |
| InChIKey | PLYZTRYGPXNDLK-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |