C18H23FN2O5S — CID 8563378
[2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 2-fluoro-5-sulfamoylbenzoate (PubChem CID 8563378) has the molecular formula C18H23FN2O5S and a molecular weight of 398.46 g/mol. Its IUPAC name is [2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 2-fluoro-5-sulfamoylbenzoate.
| Compound Name | [2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 2-fluoro-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 8563378 |
| Molecular Formula | C18H23FN2O5S |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | [2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 2-fluoro-5-sulfamoylbenzoate |
| SMILES | NS(=O)(=O)c1ccc(F)c(C(=O)OCC(=O)N2CCC[C@H]3CCCC[C@@H]32)c1 |
| InChI | InChI=1S/C18H23FN2O5S/c19-15-8-7-13(27(20,24)25)10-14(15)18(23)26-11-17(22)21-9-3-5-12-4-1-2-6-16(12)21/h7-8,10,12,16H,1-6,9,11H2,(H2,20,24,25)/t12-,16+/m1/s1 |
| InChIKey | PSNPNIJJZLRDKO-WBMJQRKESA-N |
| XLogP | 1.81 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |