C12H13BrFNO4S — CID 103715086
2-cyclopropylethyl 2-bromo-5-fluoro-3-sulfamoylbenzoate (PubChem CID 103715086) has the molecular formula C12H13BrFNO4S and a molecular weight of 366.21 g/mol. Its IUPAC name is 2-cyclopropylethyl 2-bromo-5-fluoro-3-sulfamoylbenzoate.
| Compound Name | 2-cyclopropylethyl 2-bromo-5-fluoro-3-sulfamoylbenzoate |
|---|---|
| PubChem CID | 103715086 |
| Molecular Formula | C12H13BrFNO4S |
| Molecular Weight | 366.21 g/mol |
| Exact Mass | 364.97 |
| IUPAC Name | 2-cyclopropylethyl 2-bromo-5-fluoro-3-sulfamoylbenzoate |
| SMILES | NS(=O)(=O)c1cc(F)cc(C(=O)OCCC2CC2)c1Br |
| InChI | InChI=1S/C12H13BrFNO4S/c13-11-9(12(16)19-4-3-7-1-2-7)5-8(14)6-10(11)20(15,17)18/h5-7H,1-4H2,(H2,15,17,18) |
| InChIKey | DLWBKBWHGPAWJE-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.21 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |