C12H14BrFN2O4S — CID 63932911
2-bromo-5-fluoro-N-(oxolan-3-ylmethyl)-3-sulfamoylbenzamide (PubChem CID 63932911) has the molecular formula C12H14BrFN2O4S and a molecular weight of 381.22 g/mol. Its IUPAC name is 2-bromo-5-fluoro-N-(oxolan-3-ylmethyl)-3-sulfamoylbenzamide.
| Compound Name | 2-bromo-5-fluoro-N-(oxolan-3-ylmethyl)-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 63932911 |
| Molecular Formula | C12H14BrFN2O4S |
| Molecular Weight | 381.22 g/mol |
| Exact Mass | 379.98 |
| IUPAC Name | 2-bromo-5-fluoro-N-(oxolan-3-ylmethyl)-3-sulfamoylbenzamide |
| SMILES | NS(=O)(=O)c1cc(F)cc(C(=O)NCC2CCOC2)c1Br |
| InChI | InChI=1S/C12H14BrFN2O4S/c13-11-9(3-8(14)4-10(11)21(15,18)19)12(17)16-5-7-1-2-20-6-7/h3-4,7H,1-2,5-6H2,(H,16,17)(H2,15,18,19) |
| InChIKey | ZGUGPVHEELICNK-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.22 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |