C12H14ClFN2O4S — CID 65387506
2-chloro-4-fluoro-N-(oxolan-3-ylmethyl)-5-sulfamoylbenzamide (PubChem CID 65387506) has the molecular formula C12H14ClFN2O4S and a molecular weight of 336.77 g/mol. Its IUPAC name is 2-chloro-4-fluoro-N-(oxolan-3-ylmethyl)-5-sulfamoylbenzamide.
| Compound Name | 2-chloro-4-fluoro-N-(oxolan-3-ylmethyl)-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 65387506 |
| Molecular Formula | C12H14ClFN2O4S |
| Molecular Weight | 336.77 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | 2-chloro-4-fluoro-N-(oxolan-3-ylmethyl)-5-sulfamoylbenzamide |
| SMILES | NS(=O)(=O)c1cc(C(=O)NCC2CCOC2)c(Cl)cc1F |
| InChI | InChI=1S/C12H14ClFN2O4S/c13-9-4-10(14)11(21(15,18)19)3-8(9)12(17)16-5-7-1-2-20-6-7/h3-4,7H,1-2,5-6H2,(H,16,17)(H2,15,18,19) |
| InChIKey | BUMOCTFCYBYRLA-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.77 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |