C14H19NO4S — CID 103715072
2-cyclopropylethyl 2,4-dimethyl-5-sulfamoylbenzoate (PubChem CID 103715072) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is 2-cyclopropylethyl 2,4-dimethyl-5-sulfamoylbenzoate.
| Compound Name | 2-cyclopropylethyl 2,4-dimethyl-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 103715072 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 2-cyclopropylethyl 2,4-dimethyl-5-sulfamoylbenzoate |
| SMILES | Cc1cc(C)c(S(N)(=O)=O)cc1C(=O)OCCC1CC1 |
| InChI | InChI=1S/C14H19NO4S/c1-9-7-10(2)13(20(15,17)18)8-12(9)14(16)19-6-5-11-3-4-11/h7-8,11H,3-6H2,1-2H3,(H2,15,17,18) |
| InChIKey | MDNCJGXKZRQBIJ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |