C12H12BrF2NO4S — CID 106207054
2-cyclopropylethyl 4-bromo-2,6-difluoro-3-sulfamoylbenzoate (PubChem CID 106207054) has the molecular formula C12H12BrF2NO4S and a molecular weight of 384.20 g/mol. Its IUPAC name is 2-cyclopropylethyl 4-bromo-2,6-difluoro-3-sulfamoylbenzoate.
| Compound Name | 2-cyclopropylethyl 4-bromo-2,6-difluoro-3-sulfamoylbenzoate |
|---|---|
| PubChem CID | 106207054 |
| Molecular Formula | C12H12BrF2NO4S |
| Molecular Weight | 384.20 g/mol |
| Exact Mass | 382.96 |
| IUPAC Name | 2-cyclopropylethyl 4-bromo-2,6-difluoro-3-sulfamoylbenzoate |
| SMILES | NS(=O)(=O)c1c(Br)cc(F)c(C(=O)OCCC2CC2)c1F |
| InChI | InChI=1S/C12H12BrF2NO4S/c13-7-5-8(14)9(10(15)11(7)21(16,18)19)12(17)20-4-3-6-1-2-6/h5-6H,1-4H2,(H2,16,18,19) |
| InChIKey | OEGWGKAPHIQFBS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.20 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |