C13H17BrFNO4S — CID 63947582
3,3-dimethylbutyl 2-bromo-5-fluoro-3-sulfamoylbenzoate (PubChem CID 63947582) has the molecular formula C13H17BrFNO4S and a molecular weight of 382.25 g/mol. Its IUPAC name is 3,3-dimethylbutyl 2-bromo-5-fluoro-3-sulfamoylbenzoate.
| Compound Name | 3,3-dimethylbutyl 2-bromo-5-fluoro-3-sulfamoylbenzoate |
|---|---|
| PubChem CID | 63947582 |
| Molecular Formula | C13H17BrFNO4S |
| Molecular Weight | 382.25 g/mol |
| Exact Mass | 381.00 |
| IUPAC Name | 3,3-dimethylbutyl 2-bromo-5-fluoro-3-sulfamoylbenzoate |
| SMILES | CC(C)(C)CCOC(=O)c1cc(F)cc(S(N)(=O)=O)c1Br |
| InChI | InChI=1S/C13H17BrFNO4S/c1-13(2,3)4-5-20-12(17)9-6-8(15)7-10(11(9)14)21(16,18)19/h6-7H,4-5H2,1-3H3,(H2,16,18,19) |
| InChIKey | CJYUGBAVLJXKOC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.25 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |