C10H11ClF2N2O4S — CID 115408938
5-chloro-N-(2,2-difluoroethyl)-2-methoxy-3-sulfamoylbenzamide (PubChem CID 115408938) has the molecular formula C10H11ClF2N2O4S and a molecular weight of 328.72 g/mol. Its IUPAC name is 5-chloro-N-(2,2-difluoroethyl)-2-methoxy-3-sulfamoylbenzamide.
| Compound Name | 5-chloro-N-(2,2-difluoroethyl)-2-methoxy-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 115408938 |
| Molecular Formula | C10H11ClF2N2O4S |
| Molecular Weight | 328.72 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | 5-chloro-N-(2,2-difluoroethyl)-2-methoxy-3-sulfamoylbenzamide |
| SMILES | COc1c(C(=O)NCC(F)F)cc(Cl)cc1S(N)(=O)=O |
| InChI | InChI=1S/C10H11ClF2N2O4S/c1-19-9-6(10(16)15-4-8(12)13)2-5(11)3-7(9)20(14,17)18/h2-3,8H,4H2,1H3,(H,15,16)(H2,14,17,18) |
| InChIKey | DCIIHQOKLHJGLD-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.72 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |