C12H17ClN2O5S — CID 65375386
5-chloro-2-methoxy-N-(3-methoxypropyl)-3-sulfamoylbenzamide (PubChem CID 65375386) has the molecular formula C12H17ClN2O5S and a molecular weight of 336.80 g/mol. Its IUPAC name is 5-chloro-2-methoxy-N-(3-methoxypropyl)-3-sulfamoylbenzamide.
| Compound Name | 5-chloro-2-methoxy-N-(3-methoxypropyl)-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 65375386 |
| Molecular Formula | C12H17ClN2O5S |
| Molecular Weight | 336.80 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 5-chloro-2-methoxy-N-(3-methoxypropyl)-3-sulfamoylbenzamide |
| SMILES | COCCCNC(=O)c1cc(Cl)cc(S(N)(=O)=O)c1OC |
| InChI | InChI=1S/C12H17ClN2O5S/c1-19-5-3-4-15-12(16)9-6-8(13)7-10(11(9)20-2)21(14,17)18/h6-7H,3-5H2,1-2H3,(H,15,16)(H2,14,17,18) |
| InChIKey | FGAUSGRXYWWBRK-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.80 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|