C11H14ClFN2O4S — CID 114267192
5-chloro-N-(3-fluoropropyl)-2-methoxy-3-sulfamoylbenzamide (PubChem CID 114267192) has the molecular formula C11H14ClFN2O4S and a molecular weight of 324.76 g/mol. Its IUPAC name is 5-chloro-N-(3-fluoropropyl)-2-methoxy-3-sulfamoylbenzamide.
| Compound Name | 5-chloro-N-(3-fluoropropyl)-2-methoxy-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 114267192 |
| Molecular Formula | C11H14ClFN2O4S |
| Molecular Weight | 324.76 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 5-chloro-N-(3-fluoropropyl)-2-methoxy-3-sulfamoylbenzamide |
| SMILES | COc1c(C(=O)NCCCF)cc(Cl)cc1S(N)(=O)=O |
| InChI | InChI=1S/C11H14ClFN2O4S/c1-19-10-8(11(16)15-4-2-3-13)5-7(12)6-9(10)20(14,17)18/h5-6H,2-4H2,1H3,(H,15,16)(H2,14,17,18) |
| InChIKey | KEDNQWJMRLDUPN-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.76 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|