C9H8Cl2F2N2O3S — CID 79140385
2,4-dichloro-N-(2,2-difluoroethyl)-5-sulfamoylbenzamide (PubChem CID 79140385) has the molecular formula C9H8Cl2F2N2O3S and a molecular weight of 333.14 g/mol. Its IUPAC name is 2,4-dichloro-N-(2,2-difluoroethyl)-5-sulfamoylbenzamide.
| Compound Name | 2,4-dichloro-N-(2,2-difluoroethyl)-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 79140385 |
| Molecular Formula | C9H8Cl2F2N2O3S |
| Molecular Weight | 333.14 g/mol |
| Exact Mass | 331.96 |
| IUPAC Name | 2,4-dichloro-N-(2,2-difluoroethyl)-5-sulfamoylbenzamide |
| SMILES | NS(=O)(=O)c1cc(C(=O)NCC(F)F)c(Cl)cc1Cl |
| InChI | InChI=1S/C9H8Cl2F2N2O3S/c10-5-2-6(11)7(19(14,17)18)1-4(5)9(16)15-3-8(12)13/h1-2,8H,3H2,(H,15,16)(H2,14,17,18) |
| InChIKey | QQNZZSSEQIUVKU-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.14 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |