C12H18N2O5S — CID 65375421
N-ethyl-2,4-dimethoxy-N-methyl-5-sulfamoylbenzamide (PubChem CID 65375421) has the molecular formula C12H18N2O5S and a molecular weight of 302.35 g/mol. Its IUPAC name is N-ethyl-2,4-dimethoxy-N-methyl-5-sulfamoylbenzamide.
| Compound Name | N-ethyl-2,4-dimethoxy-N-methyl-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 65375421 |
| Molecular Formula | C12H18N2O5S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | N-ethyl-2,4-dimethoxy-N-methyl-5-sulfamoylbenzamide |
| SMILES | CCN(C)C(=O)c1cc(S(N)(=O)=O)c(OC)cc1OC |
| InChI | InChI=1S/C12H18N2O5S/c1-5-14(2)12(15)8-6-11(20(13,16)17)10(19-4)7-9(8)18-3/h6-7H,5H2,1-4H3,(H2,13,16,17) |
| InChIKey | QEJMXCMBROVUMF-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |