C9H13NO3S — CID 27241719
2-methoxy-4,5-dimethylbenzenesulfonamide (PubChem CID 27241719) has the molecular formula C9H13NO3S and a molecular weight of 215.27 g/mol. Its IUPAC name is 2-methoxy-4,5-dimethylbenzenesulfonamide.
| Compound Name | 2-methoxy-4,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 27241719 |
| Molecular Formula | C9H13NO3S |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 2-methoxy-4,5-dimethylbenzenesulfonamide |
| SMILES | COc1cc(C)c(C)cc1S(N)(=O)=O |
| InChI | InChI=1S/C9H13NO3S/c1-6-4-8(13-3)9(5-7(6)2)14(10,11)12/h4-5H,1-3H3,(H2,10,11,12) |
| InChIKey | MBCDWBHJYCWQJT-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |