C9H13NO2S — CID 961422
2,4,5-trimethylbenzenesulfonamide (PubChem CID 961422) has the molecular formula C9H13NO2S and a molecular weight of 199.28 g/mol. Its IUPAC name is 2,4,5-trimethylbenzenesulfonamide.
| Compound Name | 2,4,5-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 961422 |
| Molecular Formula | C9H13NO2S |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | 2,4,5-trimethylbenzenesulfonamide |
| SMILES | Cc1cc(C)c(S(N)(=O)=O)cc1C |
| InChI | InChI=1S/C9H13NO2S/c1-6-4-8(3)9(5-7(6)2)13(10,11)12/h4-5H,1-3H3,(H2,10,11,12) |
| InChIKey | JEUPYYVSBPSDCH-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |